C20H21FN2O4S — CID 4820420
1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 4820420) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 4820420 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H21FN2O4S/c21-17-7-4-8-18(15-17)28(26,27)23-13-11-22(12-14-23)20(25)10-9-19(24)16-5-2-1-3-6-16/h1-8,15H,9-14H2 |
| InChIKey | CPVPGJLQAZSKKX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |