C19H25FN2O5S — CID 9016889
[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 9016889) has the molecular formula C19H25FN2O5S and a molecular weight of 412.48 g/mol. Its IUPAC name is [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 9016889 |
| Molecular Formula | C19H25FN2O5S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H25FN2O5S/c20-16-7-4-8-17(13-16)28(25,26)22-11-9-21(10-12-22)18(23)14-27-19(24)15-5-2-1-3-6-15/h4,7-8,13,15H,1-3,5-6,9-12,14H2 |
| InChIKey | AVXPTHYLMIIERI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |