C19H23FN2O5S — CID 8566669
[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 8566669) has the molecular formula C19H23FN2O5S and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 8566669 |
| Molecular Formula | C19H23FN2O5S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C19H23FN2O5S/c20-16-6-8-17(9-7-16)28(25,26)22-12-10-21(11-13-22)18(23)14-27-19(24)15-4-2-1-3-5-15/h1-2,6-9,15H,3-5,10-14H2/t15-/m1/s1 |
| InChIKey | IOVMXDJRYIYCFO-OAHLLOKOSA-N |
| XLogP | 1.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|