C17H21FN2O6S — CID 8808065
[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2R)-oxolane-2-carboxylate (PubChem CID 8808065) has the molecular formula C17H21FN2O6S and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2R)-oxolane-2-carboxylate.
| Compound Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 8808065 |
| Molecular Formula | C17H21FN2O6S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)[C@H]1CCCO1 |
| InChI | InChI=1S/C17H21FN2O6S/c18-13-3-5-14(6-4-13)27(23,24)20-9-7-19(8-10-20)16(21)12-26-17(22)15-2-1-11-25-15/h3-6,15H,1-2,7-12H2/t15-/m1/s1 |
| InChIKey | VFVJLGYVSYSNAC-OAHLLOKOSA-N |
| XLogP | 0.38 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |