C18H23ClN2O6S — CID 55375062
[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] oxane-4-carboxylate (PubChem CID 55375062) has the molecular formula C18H23ClN2O6S and a molecular weight of 430.91 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] oxane-4-carboxylate.
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] oxane-4-carboxylate |
|---|---|
| PubChem CID | 55375062 |
| Molecular Formula | C18H23ClN2O6S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] oxane-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)C1CCOCC1 |
| InChI | InChI=1S/C18H23ClN2O6S/c19-15-1-3-16(4-2-15)28(24,25)21-9-7-20(8-10-21)17(22)13-27-18(23)14-5-11-26-12-6-14/h1-4,14H,5-13H2 |
| InChIKey | IFOFQCNEOXFHJS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |