C16H21ClN2O6S — CID 8709251
[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 2-ethoxyacetate (PubChem CID 8709251) has the molecular formula C16H21ClN2O6S and a molecular weight of 404.87 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 8709251 |
| Molecular Formula | C16H21ClN2O6S |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN2O6S/c1-2-24-12-16(21)25-11-15(20)18-7-9-19(10-8-18)26(22,23)14-5-3-13(17)4-6-14/h3-6H,2,7-12H2,1H3 |
| InChIKey | LEFONOKQWUZLIS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |