C22H25ClN2O7S — CID 16516084
[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 16516084) has the molecular formula C22H25ClN2O7S and a molecular weight of 496.97 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 16516084 |
| Molecular Formula | C22H25ClN2O7S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1OC |
| InChI | InChI=1S/C22H25ClN2O7S/c1-3-31-19-9-4-16(14-20(19)30-2)22(27)32-15-21(26)24-10-12-25(13-11-24)33(28,29)18-7-5-17(23)6-8-18/h4-9,14H,3,10-13,15H2,1-2H3 |
| InChIKey | CRRBPPOLCWOZAJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |