C21H26N2O5S — CID 31824614
(3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 31824614) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 31824614 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-16-5-8-18(9-6-16)29(25,26)23-13-11-22(12-14-23)21(24)17-7-10-19(27-2)20(15-17)28-3/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | RLIQPQIUHKRWLE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |