C20H21F3N2O3S — CID 26181741
(4-ethylphenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 26181741) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26181741 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (4-ethylphenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-2-15-3-5-16(6-4-15)19(26)24-11-13-25(14-12-24)29(27,28)18-9-7-17(8-10-18)20(21,22)23/h3-10H,2,11-14H2,1H3 |
| InChIKey | LMWYKCPCIUEKND-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |