C18H16F4N2O3S — CID 26181722
(4-fluorophenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 26181722) has the molecular formula C18H16F4N2O3S and a molecular weight of 416.40 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26181722 |
| Molecular Formula | C18H16F4N2O3S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (4-fluorophenyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H16F4N2O3S/c19-15-5-1-13(2-6-15)17(25)23-9-11-24(12-10-23)28(26,27)16-7-3-14(4-8-16)18(20,21)22/h1-8H,9-12H2 |
| InChIKey | BHDKZZXOEBGFDK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |