C19H19FN2O5S — CID 4825564
methyl 4-[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]benzoate (PubChem CID 4825564) has the molecular formula C19H19FN2O5S and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 4-[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 4825564 |
| Molecular Formula | C19H19FN2O5S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl 4-[4-(4-fluorophenyl)sulfonylpiperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H19FN2O5S/c1-27-19(24)15-4-2-14(3-5-15)18(23)21-10-12-22(13-11-21)28(25,26)17-8-6-16(20)7-9-17/h2-9H,10-13H2,1H3 |
| InChIKey | XECBTMABDWQVCW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |