C22H20F6N2O2 — CID 46592446
[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone (PubChem CID 46592446) has the molecular formula C22H20F6N2O2 and a molecular weight of 458.40 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone.
| Compound Name | [4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 46592446 |
| Molecular Formula | C22H20F6N2O2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H20F6N2O2/c1-2-14-3-5-15(6-4-14)19(31)29-7-9-30(10-8-29)20(32)16-11-17(21(23,24)25)13-18(12-16)22(26,27)28/h3-6,11-13H,2,7-10H2,1H3 |
| InChIKey | TXWUEEKGRPYNOO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |