C20H21F3N2O — CID 113075921
[4-(4-ethylphenyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 113075921) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is [4-(4-ethylphenyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(4-ethylphenyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 113075921 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [4-(4-ethylphenyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CCc1ccc(N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21F3N2O/c1-2-15-3-9-18(10-4-15)24-11-13-25(14-12-24)19(26)16-5-7-17(8-6-16)20(21,22)23/h3-10H,2,11-14H2,1H3 |
| InChIKey | STORYPLNCSQXTE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|