C20H22F3N3O — CID 113078761
[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 113078761) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is [4-[4-(dimethylamino)phenyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[4-(dimethylamino)phenyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 113078761 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [4-[4-(dimethylamino)phenyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O/c1-24(2)17-7-9-18(10-8-17)25-11-13-26(14-12-25)19(27)15-3-5-16(6-4-15)20(21,22)23/h3-10H,11-14H2,1-2H3 |
| InChIKey | KJBMJOUVIRFWSG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|