C21H22F2N2O2S — CID 32772704
[4-[4-(difluoromethylsulfanyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone (PubChem CID 32772704) has the molecular formula C21H22F2N2O2S and a molecular weight of 404.48 g/mol. Its IUPAC name is [4-[4-(difluoromethylsulfanyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone.
| Compound Name | [4-[4-(difluoromethylsulfanyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 32772704 |
| Molecular Formula | C21H22F2N2O2S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [4-[4-(difluoromethylsulfanyl)benzoyl]piperazin-1-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3ccc(SC(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H22F2N2O2S/c1-2-15-3-5-16(6-4-15)19(26)24-11-13-25(14-12-24)20(27)17-7-9-18(10-8-17)28-21(22)23/h3-10,21H,2,11-14H2,1H3 |
| InChIKey | KUZDFYVWMDUIPG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |