C23H23F6N3O2 — CID 27851906
2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 27851906) has the molecular formula C23H23F6N3O2 and a molecular weight of 487.44 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 27851906 |
| Molecular Formula | C23H23F6N3O2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H23F6N3O2/c1-2-15-5-3-4-6-19(15)30-20(33)14-31-7-9-32(10-8-31)21(34)16-11-17(22(24,25)26)13-18(12-16)23(27,28)29/h3-6,11-13H,2,7-10,14H2,1H3,(H,30,33) |
| InChIKey | AZJPDJGOSXIEFZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |