C23H28N6O2 — CID 9022419
2-[4-(1-ethylbenzotriazole-5-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 9022419) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-[4-(1-ethylbenzotriazole-5-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-(1-ethylbenzotriazole-5-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 9022419 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[4-(1-ethylbenzotriazole-5-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)c2ccc3c(c2)nnn3CC)CC1 |
| InChI | InChI=1S/C23H28N6O2/c1-3-17-7-5-6-8-19(17)24-22(30)16-27-11-13-28(14-12-27)23(31)18-9-10-21-20(15-18)25-26-29(21)4-2/h5-10,15H,3-4,11-14,16H2,1-2H3,(H,24,30) |
| InChIKey | RQYBMVNUMUCTFS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |