C24H25N5O — CID 9397847
(1-ethylbenzotriazol-5-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone (PubChem CID 9397847) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is (1-ethylbenzotriazol-5-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (1-ethylbenzotriazol-5-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9397847 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (1-ethylbenzotriazol-5-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
| SMILES | CCn1nnc2cc(C(=O)N3CCN(Cc4cccc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C24H25N5O/c1-2-29-23-11-10-19(16-22(23)25-26-29)24(30)28-14-12-27(13-15-28)17-20-8-5-7-18-6-3-4-9-21(18)20/h3-11,16H,2,12-15,17H2,1H3 |
| InChIKey | RGQSIHPEKLVEEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |