C22H27N5O — CID 18119095
1-ethyl-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzotriazole-5-carboxamide (PubChem CID 18119095) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-ethyl-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 18119095 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-ethyl-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCc3ccccc3CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C22H27N5O/c1-2-27-21-11-10-17(14-20(21)24-25-27)22(28)23-15-18-8-4-5-9-19(18)16-26-12-6-3-7-13-26/h4-5,8-11,14H,2-3,6-7,12-13,15-16H2,1H3,(H,23,28) |
| InChIKey | WNNTWJMNSWMEFF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |