C24H26N2OS — CID 9398005
[3-(methylsulfanylmethyl)phenyl]-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone (PubChem CID 9398005) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is [3-(methylsulfanylmethyl)phenyl]-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [3-(methylsulfanylmethyl)phenyl]-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9398005 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [3-(methylsulfanylmethyl)phenyl]-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
| SMILES | CSCc1cccc(C(=O)N2CCN(Cc3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H26N2OS/c1-28-18-19-6-4-9-21(16-19)24(27)26-14-12-25(13-15-26)17-22-10-5-8-20-7-2-3-11-23(20)22/h2-11,16H,12-15,17-18H2,1H3 |
| InChIKey | NRMHZRWADDSONC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |