C23H27N3O4 — CID 9022475
[4-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazine-1-carbonyl]phenyl] acetate (PubChem CID 9022475) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [4-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 9022475 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [4-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)c2ccc(OC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O4/c1-3-18-6-4-5-7-21(18)24-22(28)16-25-12-14-26(15-13-25)23(29)19-8-10-20(11-9-19)30-17(2)27/h4-11H,3,12-16H2,1-2H3,(H,24,28) |
| InChIKey | IBQKZHHQXXAIMZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|