C23H26F3N3O3 — CID 39015022
N-(2-ethylphenyl)-2-[4-[2-[2-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]acetamide (PubChem CID 39015022) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-[2-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-[2-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 39015022 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-[2-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)COc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H26F3N3O3/c1-2-17-7-3-5-9-19(17)27-21(30)15-28-11-13-29(14-12-28)22(31)16-32-20-10-6-4-8-18(20)23(24,25)26/h3-10H,2,11-16H2,1H3,(H,27,30) |
| InChIKey | CQFSAQHKAXWSEM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |