C16H21F3N2O3 — CID 95607032
1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone (PubChem CID 95607032) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 95607032 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone |
| SMILES | C[C@@H](O)CN1CCN(C(=O)COc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-12(22)10-20-6-8-21(9-7-20)15(23)11-24-14-5-3-2-4-13(14)16(17,18)19/h2-5,12,22H,6-11H2,1H3/t12-/m1/s1 |
| InChIKey | KNTABXNEELJOFV-GFCCVEGCSA-N |
| XLogP | 1.61 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |