C17H26N2O4 — CID 95345574
1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 95345574) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 95345574 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | CC[C@@H](O)CN1CCN(C(=O)COc2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-3-14(20)12-18-8-10-19(11-9-18)17(21)13-23-16-7-5-4-6-15(16)22-2/h4-7,14,20H,3,8-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | LTYWNHWAWQEWJQ-CQSZACIVSA-N |
| XLogP | 0.99 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |