C17H25N3O4 — CID 56803124
4-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethoxy]benzamide (PubChem CID 56803124) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 56803124 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethoxy]benzamide |
| SMILES | CCC(O)CN1CCN(C(=O)COc2ccc(C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-2-14(21)11-19-7-9-20(10-8-19)16(22)12-24-15-5-3-13(4-6-15)17(18)23/h3-6,14,21H,2,7-12H2,1H3,(H2,18,23) |
| InChIKey | REFGWUPUBYSTQR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |