C17H26N2O4 — CID 95352392
1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-(2-phenoxyethoxy)ethanone (PubChem CID 95352392) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-(2-phenoxyethoxy)ethanone.
| Compound Name | 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-(2-phenoxyethoxy)ethanone |
|---|---|
| PubChem CID | 95352392 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-2-(2-phenoxyethoxy)ethanone |
| SMILES | C[C@@H](O)CN1CCN(C(=O)COCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-15(20)13-18-7-9-19(10-8-18)17(21)14-22-11-12-23-16-5-3-2-4-6-16/h2-6,15,20H,7-14H2,1H3/t15-/m1/s1 |
| InChIKey | LGAAZTWFWBHGBA-OAHLLOKOSA-N |
| XLogP | 0.61 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|