C17H25FN2O3 — CID 95348392
4-(4-fluorophenoxy)-1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]butan-1-one (PubChem CID 95348392) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-fluorophenoxy)-1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 95348392 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-(4-fluorophenoxy)-1-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]butan-1-one |
| SMILES | C[C@@H](O)CN1CCN(C(=O)CCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H25FN2O3/c1-14(21)13-19-8-10-20(11-9-19)17(22)3-2-12-23-16-6-4-15(18)5-7-16/h4-7,14,21H,2-3,8-13H2,1H3/t14-/m1/s1 |
| InChIKey | HIXLQRCVOGOPOI-CQSZACIVSA-N |
| XLogP | 1.51 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|