C14H18FNO3 — CID 79031097
4-(4-fluorophenoxy)-1-[(3S)-3-hydroxypyrrolidin-1-yl]butan-1-one (PubChem CID 79031097) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-1-[(3S)-3-hydroxypyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(4-fluorophenoxy)-1-[(3S)-3-hydroxypyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 79031097 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(4-fluorophenoxy)-1-[(3S)-3-hydroxypyrrolidin-1-yl]butan-1-one |
| SMILES | O=C(CCCOc1ccc(F)cc1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C14H18FNO3/c15-11-3-5-13(6-4-11)19-9-1-2-14(18)16-8-7-12(17)10-16/h3-6,12,17H,1-2,7-10H2/t12-/m0/s1 |
| InChIKey | PPYFDXOXPTXPQF-LBPRGKRZSA-N |
| XLogP | 1.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|