C17H24ClFN2O2 — CID 119636236
1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-4-(4-fluorophenoxy)butan-1-one;hydrochloride (PubChem CID 119636236) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-4-(4-fluorophenoxy)butan-1-one;hydrochloride.
| Compound Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-4-(4-fluorophenoxy)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119636236 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-4-(4-fluorophenoxy)butan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCOc1ccc(F)cc1)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C17H23FN2O2.ClH/c18-13-3-7-16(8-4-13)22-11-1-2-17(21)20-10-9-14-5-6-15(12-20)19-14;/h3-4,7-8,14-15,19H,1-2,5-6,9-12H2;1H |
| InChIKey | JADHXZQBPZACGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|