C21H24FNO2 — CID 44765669
1-[4-(4-fluorophenyl)piperidin-1-yl]-4-phenoxybutan-1-one (PubChem CID 44765669) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperidin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-(4-fluorophenyl)piperidin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 44765669 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperidin-1-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FNO2/c22-19-10-8-17(9-11-19)18-12-14-23(15-13-18)21(24)7-4-16-25-20-5-2-1-3-6-20/h1-3,5-6,8-11,18H,4,7,12-16H2 |
| InChIKey | KHCXARFZZQDGBL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|