C22H27FN2O3 — CID 46445331
2-(4-fluorophenyl)-1-[4-[2-hydroxy-3-(4-methylphenoxy)propyl]piperazin-1-yl]ethanone (PubChem CID 46445331) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[4-[2-hydroxy-3-(4-methylphenoxy)propyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[4-[2-hydroxy-3-(4-methylphenoxy)propyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46445331 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[4-[2-hydroxy-3-(4-methylphenoxy)propyl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(OCC(O)CN2CCN(C(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27FN2O3/c1-17-2-8-21(9-3-17)28-16-20(26)15-24-10-12-25(13-11-24)22(27)14-18-4-6-19(23)7-5-18/h2-9,20,26H,10-16H2,1H3 |
| InChIKey | RXWYCMFTCDVLJW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |