C18H21FN2O4 — CID 34955644
[4-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 34955644) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is [4-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 34955644 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [4-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCN(C[C@@H](O)COc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H21FN2O4/c19-15-1-3-17(4-2-15)25-13-16(22)11-20-6-8-21(9-7-20)18(23)14-5-10-24-12-14/h1-5,10,12,16,22H,6-9,11,13H2/t16-/m1/s1 |
| InChIKey | ZKPPUXQPRCMEMX-MRXNPFEDSA-N |
| XLogP | 1.62 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |