C21H31ClF4N2O3 — CID 141189376
1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-7-(trifluoromethoxy)octan-1-one;hydrochloride (PubChem CID 141189376) has the molecular formula C21H31ClF4N2O3 and a molecular weight of 470.94 g/mol. Its IUPAC name is 1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-7-(trifluoromethoxy)octan-1-one;hydrochloride.
| Compound Name | 1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-7-(trifluoromethoxy)octan-1-one;hydrochloride |
|---|---|
| PubChem CID | 141189376 |
| Molecular Formula | C21H31ClF4N2O3 |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 1-[4-[2-(4-fluorophenoxy)ethyl]piperazin-1-yl]-7-(trifluoromethoxy)octan-1-one;hydrochloride |
| SMILES | CC(CCCCCC(=O)N1CCN(CCOc2ccc(F)cc2)CC1)OC(F)(F)F.Cl |
| InChI | InChI=1S/C21H30F4N2O3.ClH/c1-17(30-21(23,24)25)5-3-2-4-6-20(28)27-13-11-26(12-14-27)15-16-29-19-9-7-18(22)8-10-19;/h7-10,17H,2-6,11-16H2,1H3;1H |
| InChIKey | HTSQFEYDTBTPFX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|