C20H20ClF3N2O2 — CID 22265251
1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone (PubChem CID 22265251) has the molecular formula C20H20ClF3N2O2 and a molecular weight of 412.84 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 22265251 |
| Molecular Formula | C20H20ClF3N2O2 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[2-(trifluoromethyl)phenoxy]ethanone |
| SMILES | O=C(COc1ccccc1C(F)(F)F)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H20ClF3N2O2/c21-16-7-5-15(6-8-16)13-25-9-11-26(12-10-25)19(27)14-28-18-4-2-1-3-17(18)20(22,23)24/h1-8H,9-14H2 |
| InChIKey | JVTFGKMVRZOECQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |