C21H23ClN2O5 — CID 22265114
4-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-methoxybenzoic acid (PubChem CID 22265114) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 22265114 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O5/c1-28-19-12-16(21(26)27)4-7-18(19)29-14-20(25)24-10-8-23(9-11-24)13-15-2-5-17(22)6-3-15/h2-7,12H,8-11,13-14H2,1H3,(H,26,27) |
| InChIKey | ABFRJLZYTRZNFV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |