C19H18ClF3N2O2 — CID 22264972
1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone (PubChem CID 22264972) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone |
|---|---|
| PubChem CID | 22264972 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(2,3,4-trifluorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(F)c(F)c1F)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H18ClF3N2O2/c20-14-3-1-13(2-4-14)11-24-7-9-25(10-8-24)17(26)12-27-16-6-5-15(21)18(22)19(16)23/h1-6H,7-12H2 |
| InChIKey | ACSBPRPZTQUSGC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|