C19H19Cl2N3O4 — CID 22263902
2-(2-chloro-4-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 22263902) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 22263902 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H19Cl2N3O4/c20-15-3-1-14(2-4-15)12-22-7-9-23(10-8-22)19(25)13-28-18-6-5-16(24(26)27)11-17(18)21/h1-6,11H,7-10,12-13H2 |
| InChIKey | KRHVQWDBGKWCSX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|