C16H18ClN3O5 — CID 55849111
2-(2-chloro-4-nitrophenoxy)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone (PubChem CID 55849111) has the molecular formula C16H18ClN3O5 and a molecular weight of 367.79 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55849111 |
| Molecular Formula | C16H18ClN3O5 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C16H18ClN3O5/c17-13-9-12(20(23)24)3-4-14(13)25-10-15(21)18-5-7-19(8-6-18)16(22)11-1-2-11/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | OJEKGYAYSUFDDQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|