C19H17ClN2O4 — CID 8587566
2-(2-chloro-4-nitrophenoxy)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone (PubChem CID 8587566) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 8587566 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-17-12-16(22(24)25)6-7-18(17)26-13-19(23)21-10-8-15(9-11-21)14-4-2-1-3-5-14/h1-8,12H,9-11,13H2 |
| InChIKey | FZKHOVLJHSTRKS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|