C17H21N3O7S — CID 51937724
1-[4-[(3S)-1,1-dioxothiolane-3-carbonyl]piperazin-1-yl]-2-(3-nitrophenoxy)ethanone (PubChem CID 51937724) has the molecular formula C17H21N3O7S and a molecular weight of 411.44 g/mol. Its IUPAC name is 1-[4-[(3S)-1,1-dioxothiolane-3-carbonyl]piperazin-1-yl]-2-(3-nitrophenoxy)ethanone.
| Compound Name | 1-[4-[(3S)-1,1-dioxothiolane-3-carbonyl]piperazin-1-yl]-2-(3-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 51937724 |
| Molecular Formula | C17H21N3O7S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[4-[(3S)-1,1-dioxothiolane-3-carbonyl]piperazin-1-yl]-2-(3-nitrophenoxy)ethanone |
| SMILES | O=C(COc1cccc([N+](=O)[O-])c1)N1CCN(C(=O)[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H21N3O7S/c21-16(11-27-15-3-1-2-14(10-15)20(23)24)18-5-7-19(8-6-18)17(22)13-4-9-28(25,26)12-13/h1-3,10,13H,4-9,11-12H2/t13-/m1/s1 |
| InChIKey | WEKYKLYGYHDBHN-CYBMUJFWSA-N |
| XLogP | 0.08 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|