C19H18ClF2N3O4 — CID 55733558
1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(2-fluoro-4-nitrophenoxy)ethanone (PubChem CID 55733558) has the molecular formula C19H18ClF2N3O4 and a molecular weight of 425.82 g/mol. Its IUPAC name is 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(2-fluoro-4-nitrophenoxy)ethanone.
| Compound Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(2-fluoro-4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 55733558 |
| Molecular Formula | C19H18ClF2N3O4 |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-(2-fluoro-4-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1F)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H18ClF2N3O4/c20-15-2-1-3-16(21)14(15)11-23-6-8-24(9-7-23)19(26)12-29-18-5-4-13(25(27)28)10-17(18)22/h1-5,10H,6-9,11-12H2 |
| InChIKey | DZIXCHWKAIXAKB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|