C15H18FN3O6 — CID 46484700
ethyl 4-[2-(2-fluoro-4-nitrophenoxy)acetyl]piperazine-1-carboxylate (PubChem CID 46484700) has the molecular formula C15H18FN3O6 and a molecular weight of 355.32 g/mol. Its IUPAC name is ethyl 4-[2-(2-fluoro-4-nitrophenoxy)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-fluoro-4-nitrophenoxy)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46484700 |
| Molecular Formula | C15H18FN3O6 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 4-[2-(2-fluoro-4-nitrophenoxy)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COc2ccc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C15H18FN3O6/c1-2-24-15(21)18-7-5-17(6-8-18)14(20)10-25-13-4-3-11(19(22)23)9-12(13)16/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | OFLBCLNOOKMDGG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|