C13H16ClN3O6S — CID 4089047
ethyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 4089047) has the molecular formula C13H16ClN3O6S and a molecular weight of 377.81 g/mol. Its IUPAC name is ethyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 4089047 |
| Molecular Formula | C13H16ClN3O6S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | ethyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClN3O6S/c1-2-23-13(18)15-5-7-16(8-6-15)24(21,22)12-9-10(17(19)20)3-4-11(12)14/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | GCPHICFQVSUKGB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|