C21H23Cl3N4O10S2 — CID 159735971
tert-butyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate;2-chloro-5-nitrobenzenesulfonyl chloride (PubChem CID 159735971) has the molecular formula C21H23Cl3N4O10S2 and a molecular weight of 661.93 g/mol. Its IUPAC name is tert-butyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate;2-chloro-5-nitrobenzenesulfonyl chloride.
| Compound Name | tert-butyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate;2-chloro-5-nitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 159735971 |
| Molecular Formula | C21H23Cl3N4O10S2 |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 659.99 |
| IUPAC Name | tert-butyl 4-(2-chloro-5-nitrophenyl)sulfonylpiperazine-1-carboxylate;2-chloro-5-nitrobenzenesulfonyl chloride |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)CC1.O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O6S.C6H3Cl2NO4S/c1-15(2,3)25-14(20)17-6-8-18(9-7-17)26(23,24)13-10-11(19(21)22)4-5-12(13)16;7-5-2-1-4(9(10)11)3-6(5)14(8,12)13/h4-5,10H,6-9H2,1-3H3;1-3H |
| InChIKey | NBVQVGYGUVZFCK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|