C19H23ClN2O4S — CID 18761390
tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carboxylate (PubChem CID 18761390) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 18761390 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CC1 |
| InChI | InChI=1S/C19H23ClN2O4S/c1-19(2,3)26-18(23)21-8-10-22(11-9-21)27(24,25)17-7-5-14-12-16(20)6-4-15(14)13-17/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | CDLPHFUPNOKOCX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |