C15H21ClN2O4S — CID 2796253
tert-butyl 4-(4-chlorophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 2796253) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is tert-butyl 4-(4-chlorophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chlorophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 2796253 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | tert-butyl 4-(4-chlorophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-15(2,3)22-14(19)17-8-10-18(11-9-17)23(20,21)13-6-4-12(16)5-7-13/h4-7H,8-11H2,1-3H3 |
| InChIKey | XVOBINBTLCYECZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |