C15H22ClN3O3S — CID 110811078
N-tert-butyl-4-(4-chlorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 110811078) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is N-tert-butyl-4-(4-chlorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-(4-chlorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110811078 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-tert-butyl-4-(4-chlorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-15(2,3)17-14(20)18-8-10-19(11-9-18)23(21,22)13-6-4-12(16)5-7-13/h4-7H,8-11H2,1-3H3,(H,17,20) |
| InChIKey | KWMBVXCVPXBFTJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |