C15H19ClN2O3S — CID 110797074
[4-(4-chlorophenyl)sulfonyl-1,4-diazepan-1-yl]-cyclopropylmethanone (PubChem CID 110797074) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfonyl-1,4-diazepan-1-yl]-cyclopropylmethanone.
| Compound Name | [4-(4-chlorophenyl)sulfonyl-1,4-diazepan-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 110797074 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [4-(4-chlorophenyl)sulfonyl-1,4-diazepan-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H19ClN2O3S/c16-13-4-6-14(7-5-13)22(20,21)18-9-1-8-17(10-11-18)15(19)12-2-3-12/h4-7,12H,1-3,8-11H2 |
| InChIKey | HNROPSJDOCUWMK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |