C16H22ClN3O3S — CID 119678354
(3-aminocyclopentyl)-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 119678354) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is (3-aminocyclopentyl)-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-aminocyclopentyl)-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119678354 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3-aminocyclopentyl)-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | NC1CCC(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C16H22ClN3O3S/c17-13-2-5-15(6-3-13)24(22,23)20-9-7-19(8-10-20)16(21)12-1-4-14(18)11-12/h2-3,5-6,12,14H,1,4,7-11,18H2 |
| InChIKey | MVEFCKCECVJCJM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |