C19H28ClN3O5S2 — CID 46489746
[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(1-propylsulfonylpiperidin-3-yl)methanone (PubChem CID 46489746) has the molecular formula C19H28ClN3O5S2 and a molecular weight of 478.04 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(1-propylsulfonylpiperidin-3-yl)methanone.
| Compound Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(1-propylsulfonylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 46489746 |
| Molecular Formula | C19H28ClN3O5S2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(1-propylsulfonylpiperidin-3-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C19H28ClN3O5S2/c1-2-14-29(25,26)23-9-3-4-16(15-23)19(24)21-10-12-22(13-11-21)30(27,28)18-7-5-17(20)6-8-18/h5-8,16H,2-4,9-15H2,1H3 |
| InChIKey | MGRNVGXKMWASQT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |